C13H13NO2Se2 — CID 102498527
4-(benzenecarbonoselenoylselanyl)-4-cyanopentanoic acid (PubChem CID 102498527) has the molecular formula C13H13NO2Se2 and a molecular weight of 373.17 g/mol. Its IUPAC name is 4-(benzenecarbonoselenoylselanyl)-4-cyanopentanoic acid.
| Compound Name | 4-(benzenecarbonoselenoylselanyl)-4-cyanopentanoic acid |
|---|---|
| PubChem CID | 102498527 |
| Molecular Formula | C13H13NO2Se2 |
| Molecular Weight | 373.17 g/mol |
| Exact Mass | 374.93 |
| IUPAC Name | 4-(benzenecarbonoselenoylselanyl)-4-cyanopentanoic acid |
| SMILES | CC(C#N)(CCC(=O)O)[Se]C(=[Se])c1ccccc1 |
| InChI | InChI=1S/C13H13NO2Se2/c1-13(9-14,8-7-11(15)16)18-12(17)10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,15,16) |
| InChIKey | CJWWSCPWZYVWEO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|