C25H37N3O3S2 — CID 146507503
6-(2-aminoethylcarbamoyl)-8-(benzenecarbonothioylsulfanyl)-4-cyano-4,5,5,6,8-pentamethylnonanoic acid (PubChem CID 146507503) has the molecular formula C25H37N3O3S2 and a molecular weight of 491.72 g/mol. Its IUPAC name is 6-(2-aminoethylcarbamoyl)-8-(benzenecarbonothioylsulfanyl)-4-cyano-4,5,5,6,8-pentamethylnonanoic acid.
| Compound Name | 6-(2-aminoethylcarbamoyl)-8-(benzenecarbonothioylsulfanyl)-4-cyano-4,5,5,6,8-pentamethylnonanoic acid |
|---|---|
| PubChem CID | 146507503 |
| Molecular Formula | C25H37N3O3S2 |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 6-(2-aminoethylcarbamoyl)-8-(benzenecarbonothioylsulfanyl)-4-cyano-4,5,5,6,8-pentamethylnonanoic acid |
| SMILES | CC(C)(CC(C)(C(=O)NCCN)C(C)(C)C(C)(C#N)CCC(=O)O)SC(=S)c1ccccc1 |
| InChI | InChI=1S/C25H37N3O3S2/c1-22(2,33-20(32)18-10-8-7-9-11-18)16-25(6,21(31)28-15-14-26)23(3,4)24(5,17-27)13-12-19(29)30/h7-11H,12-16,26H2,1-6H3,(H,28,31)(H,29,30) |
| InChIKey | WSXKJEDAEUFEGB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|