C19H17NO2S — CID 4287610
N-(2-oxothiolan-3-yl)-2,3-diphenylprop-2-enamide (PubChem CID 4287610) has the molecular formula C19H17NO2S and a molecular weight of 323.42 g/mol. Its IUPAC name is N-(2-oxothiolan-3-yl)-2,3-diphenylprop-2-enamide.
| Compound Name | N-(2-oxothiolan-3-yl)-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 4287610 |
| Molecular Formula | C19H17NO2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-(2-oxothiolan-3-yl)-2,3-diphenylprop-2-enamide |
| SMILES | O=C(NC1CCSC1=O)C(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17NO2S/c21-18(20-17-11-12-23-19(17)22)16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-10,13,17H,11-12H2,(H,20,21) |
| InChIKey | QWXYEUPWZFRFJV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|