C23H26N2O — CID 67845558
N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-2,3-diphenylprop-2-enamide (PubChem CID 67845558) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-2,3-diphenylprop-2-enamide.
| Compound Name | N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 67845558 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-2,3-diphenylprop-2-enamide |
| SMILES | CN1C2CCC1CC(NC(=O)C(=Cc1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C23H26N2O/c1-25-20-12-13-21(25)16-19(15-20)24-23(26)22(18-10-6-3-7-11-18)14-17-8-4-2-5-9-17/h2-11,14,19-21H,12-13,15-16H2,1H3,(H,24,26) |
| InChIKey | MMCAANAQHGXBPI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|