C24H28ClNO3 — CID 6432634
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) (E)-2-(4-methoxyphenyl)-3-phenylprop-2-enoate;hydrochloride (PubChem CID 6432634) has the molecular formula C24H28ClNO3 and a molecular weight of 413.95 g/mol. Its IUPAC name is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) (E)-2-(4-methoxyphenyl)-3-phenylprop-2-enoate;hydrochloride.
| Compound Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) (E)-2-(4-methoxyphenyl)-3-phenylprop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 6432634 |
| Molecular Formula | C24H28ClNO3 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) (E)-2-(4-methoxyphenyl)-3-phenylprop-2-enoate;hydrochloride |
| SMILES | COc1ccc(/C(=C\c2ccccc2)C(=O)OC2CC3CCC(C2)N3C)cc1.Cl |
| InChI | InChI=1S/C24H27NO3.ClH/c1-25-19-10-11-20(25)16-22(15-19)28-24(26)23(14-17-6-4-3-5-7-17)18-8-12-21(27-2)13-9-18;/h3-9,12-14,19-20,22H,10-11,15-16H2,1-2H3;1H/b23-14+; |
| InChIKey | OQHHZEFVSMQGHE-MHVDTSALSA-N |
| XLogP | 4.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|