C24H27Cl2NO3 — CID 6434993
(8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) (E)-3-(4-chlorophenyl)-2-(4-methoxyphenyl)prop-2-enoate chloride (PubChem CID 6434993) has the molecular formula C24H27Cl2NO3 and a molecular weight of 448.39 g/mol. Its IUPAC name is (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) (E)-3-(4-chlorophenyl)-2-(4-methoxyphenyl)prop-2-enoate chloride.
| Compound Name | (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) (E)-3-(4-chlorophenyl)-2-(4-methoxyphenyl)prop-2-enoate chloride |
|---|---|
| PubChem CID | 6434993 |
| Molecular Formula | C24H27Cl2NO3 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) (E)-3-(4-chlorophenyl)-2-(4-methoxyphenyl)prop-2-enoate chloride |
| SMILES | COc1ccc(/C(=C\c2ccc(Cl)cc2)C(=O)OC2CC3CCC(C2)[NH+]3C)cc1.[Cl-] |
| InChI | InChI=1S/C24H26ClNO3.ClH/c1-26-19-9-10-20(26)15-22(14-19)29-24(27)23(13-16-3-7-18(25)8-4-16)17-5-11-21(28-2)12-6-17;/h3-8,11-13,19-20,22H,9-10,14-15H2,1-2H3;1H/b23-13+; |
| InChIKey | LICYFKWVZVSLBN-PUZWSPMBSA-N |
| XLogP | 0.64 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|