C25H23NO3 — CID 108757184
(E)-N-(3,4-dihydro-2H-chromen-4-yl)-3-(4-methoxyphenyl)-2-phenylprop-2-enamide (PubChem CID 108757184) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is (E)-N-(3,4-dihydro-2H-chromen-4-yl)-3-(4-methoxyphenyl)-2-phenylprop-2-enamide.
| Compound Name | (E)-N-(3,4-dihydro-2H-chromen-4-yl)-3-(4-methoxyphenyl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 108757184 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (E)-N-(3,4-dihydro-2H-chromen-4-yl)-3-(4-methoxyphenyl)-2-phenylprop-2-enamide |
| SMILES | COc1ccc(/C=C(/C(=O)NC2CCOc3ccccc32)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23NO3/c1-28-20-13-11-18(12-14-20)17-22(19-7-3-2-4-8-19)25(27)26-23-15-16-29-24-10-6-5-9-21(23)24/h2-14,17,23H,15-16H2,1H3,(H,26,27)/b22-17+ |
| InChIKey | KXPONEFMFPLHDV-OQKWZONESA-N |
| XLogP | 4.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|