C26H25NO4 — CID 108757186
(E)-N-(3,4-dihydro-2H-chromen-4-yl)-3-(3,4-dimethoxyphenyl)-2-phenylprop-2-enamide (PubChem CID 108757186) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is (E)-N-(3,4-dihydro-2H-chromen-4-yl)-3-(3,4-dimethoxyphenyl)-2-phenylprop-2-enamide.
| Compound Name | (E)-N-(3,4-dihydro-2H-chromen-4-yl)-3-(3,4-dimethoxyphenyl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 108757186 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (E)-N-(3,4-dihydro-2H-chromen-4-yl)-3-(3,4-dimethoxyphenyl)-2-phenylprop-2-enamide |
| SMILES | COc1ccc(/C=C(/C(=O)NC2CCOc3ccccc32)c2ccccc2)cc1OC |
| InChI | InChI=1S/C26H25NO4/c1-29-24-13-12-18(17-25(24)30-2)16-21(19-8-4-3-5-9-19)26(28)27-22-14-15-31-23-11-7-6-10-20(22)23/h3-13,16-17,22H,14-15H2,1-2H3,(H,27,28)/b21-16+ |
| InChIKey | IDQWDWJYQVEOLE-LTGZKZEYSA-N |
| XLogP | 4.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|