C15H17N3O2S — CID 3474281
2-(2,3-dihydroindol-1-ylimino)-N-(2-oxothiolan-3-yl)propanamide (PubChem CID 3474281) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-ylimino)-N-(2-oxothiolan-3-yl)propanamide.
| Compound Name | 2-(2,3-dihydroindol-1-ylimino)-N-(2-oxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 3474281 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-(2,3-dihydroindol-1-ylimino)-N-(2-oxothiolan-3-yl)propanamide |
| SMILES | CC(=NN1CCc2ccccc21)C(=O)NC1CCSC1=O |
| InChI | InChI=1S/C15H17N3O2S/c1-10(14(19)16-12-7-9-21-15(12)20)17-18-8-6-11-4-2-3-5-13(11)18/h2-5,12H,6-9H2,1H3,(H,16,19) |
| InChIKey | HDWANHZSROSXCX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|