C12H13NO3S2 — CID 71873084
2-(4-hydroxyphenyl)sulfanyl-N-(2-oxothiolan-3-yl)acetamide (PubChem CID 71873084) has the molecular formula C12H13NO3S2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)sulfanyl-N-(2-oxothiolan-3-yl)acetamide.
| Compound Name | 2-(4-hydroxyphenyl)sulfanyl-N-(2-oxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 71873084 |
| Molecular Formula | C12H13NO3S2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 2-(4-hydroxyphenyl)sulfanyl-N-(2-oxothiolan-3-yl)acetamide |
| SMILES | O=C(CSc1ccc(O)cc1)NC1CCSC1=O |
| InChI | InChI=1S/C12H13NO3S2/c14-8-1-3-9(4-2-8)18-7-11(15)13-10-5-6-17-12(10)16/h1-4,10,14H,5-7H2,(H,13,15) |
| InChIKey | WEBWGTNBIKPHEQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|