C11H17NO4S2 — CID 129318624
propan-2-yl 2-[2-oxo-2-[(2-oxothiolan-3-yl)amino]ethyl]sulfanylacetate (PubChem CID 129318624) has the molecular formula C11H17NO4S2 and a molecular weight of 291.39 g/mol. Its IUPAC name is propan-2-yl 2-[2-oxo-2-[(2-oxothiolan-3-yl)amino]ethyl]sulfanylacetate.
| Compound Name | propan-2-yl 2-[2-oxo-2-[(2-oxothiolan-3-yl)amino]ethyl]sulfanylacetate |
|---|---|
| PubChem CID | 129318624 |
| Molecular Formula | C11H17NO4S2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | propan-2-yl 2-[2-oxo-2-[(2-oxothiolan-3-yl)amino]ethyl]sulfanylacetate |
| SMILES | CC(C)OC(=O)CSCC(=O)NC1CCSC1=O |
| InChI | InChI=1S/C11H17NO4S2/c1-7(2)16-10(14)6-17-5-9(13)12-8-3-4-18-11(8)15/h7-8H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | CURJJQVBBWZULJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|