C12H14N2O2S2 — CID 124607487
2-[(5-methyl-2-pyridinyl)sulfanyl]-N-[(3S)-2-oxothiolan-3-yl]acetamide (PubChem CID 124607487) has the molecular formula C12H14N2O2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-[(5-methyl-2-pyridinyl)sulfanyl]-N-[(3S)-2-oxothiolan-3-yl]acetamide.
| Compound Name | 2-[(5-methyl-2-pyridinyl)sulfanyl]-N-[(3S)-2-oxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 124607487 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-[(5-methyl-2-pyridinyl)sulfanyl]-N-[(3S)-2-oxothiolan-3-yl]acetamide |
| SMILES | Cc1ccc(SCC(=O)N[C@H]2CCSC2=O)nc1 |
| InChI | InChI=1S/C12H14N2O2S2/c1-8-2-3-11(13-6-8)18-7-10(15)14-9-4-5-17-12(9)16/h2-3,6,9H,4-5,7H2,1H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | QQFZKTOJYMUIQA-VIFPVBQESA-N |
| XLogP | 1.63 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|