C12H16N2O4S3 — CID 71316399
2-[2-oxo-2-[(2-oxothiolan-3-yl)amino]ethyl]sulfanyl-N-(2-oxothiolan-3-yl)acetamide (PubChem CID 71316399) has the molecular formula C12H16N2O4S3 and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-[2-oxo-2-[(2-oxothiolan-3-yl)amino]ethyl]sulfanyl-N-(2-oxothiolan-3-yl)acetamide.
| Compound Name | 2-[2-oxo-2-[(2-oxothiolan-3-yl)amino]ethyl]sulfanyl-N-(2-oxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 71316399 |
| Molecular Formula | C12H16N2O4S3 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-[2-oxo-2-[(2-oxothiolan-3-yl)amino]ethyl]sulfanyl-N-(2-oxothiolan-3-yl)acetamide |
| SMILES | O=C(CSCC(=O)NC1CCSC1=O)NC1CCSC1=O |
| InChI | InChI=1S/C12H16N2O4S3/c15-9(13-7-1-3-20-11(7)17)5-19-6-10(16)14-8-2-4-21-12(8)18/h7-8H,1-6H2,(H,13,15)(H,14,16) |
| InChIKey | ZDLGRWLIZGRLAD-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|