C12H12FNO2S — CID 798537
2-(4-fluorophenyl)-N-[(3R)-2-oxothiolan-3-yl]acetamide (PubChem CID 798537) has the molecular formula C12H12FNO2S and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[(3R)-2-oxothiolan-3-yl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[(3R)-2-oxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 798537 |
| Molecular Formula | C12H12FNO2S |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[(3R)-2-oxothiolan-3-yl]acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)N[C@@H]1CCSC1=O |
| InChI | InChI=1S/C12H12FNO2S/c13-9-3-1-8(2-4-9)7-11(15)14-10-5-6-17-12(10)16/h1-4,10H,5-7H2,(H,14,15)/t10-/m1/s1 |
| InChIKey | FVBFSDFMOWPXTK-SNVBAGLBSA-N |
| XLogP | 1.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|