C13H15FN2O4S2 — CID 17192160
3-[(4-fluorophenyl)sulfonylamino]-N-(2-oxothiolan-3-yl)propanamide (PubChem CID 17192160) has the molecular formula C13H15FN2O4S2 and a molecular weight of 346.41 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)sulfonylamino]-N-(2-oxothiolan-3-yl)propanamide.
| Compound Name | 3-[(4-fluorophenyl)sulfonylamino]-N-(2-oxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 17192160 |
| Molecular Formula | C13H15FN2O4S2 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 3-[(4-fluorophenyl)sulfonylamino]-N-(2-oxothiolan-3-yl)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(F)cc1)NC1CCSC1=O |
| InChI | InChI=1S/C13H15FN2O4S2/c14-9-1-3-10(4-2-9)22(19,20)15-7-5-12(17)16-11-6-8-21-13(11)18/h1-4,11,15H,5-8H2,(H,16,17) |
| InChIKey | UCSCJMKJAILFEA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|