C12H11FN2O2S2 — CID 886336
4-fluoro-N-[[(3R)-2-oxothiolan-3-yl]carbamothioyl]benzamide (PubChem CID 886336) has the molecular formula C12H11FN2O2S2 and a molecular weight of 298.36 g/mol. Its IUPAC name is 4-fluoro-N-[[(3R)-2-oxothiolan-3-yl]carbamothioyl]benzamide.
| Compound Name | 4-fluoro-N-[[(3R)-2-oxothiolan-3-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 886336 |
| Molecular Formula | C12H11FN2O2S2 |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 4-fluoro-N-[[(3R)-2-oxothiolan-3-yl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)N[C@@H]1CCSC1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H11FN2O2S2/c13-8-3-1-7(2-4-8)10(16)15-12(18)14-9-5-6-19-11(9)17/h1-4,9H,5-6H2,(H2,14,15,16,18)/t9-/m1/s1 |
| InChIKey | ADAREQPVNRNWRS-SECBINFHSA-N |
| XLogP | 1.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|