C10H10N2O3S2 — CID 702120
N-[[(3R)-2-oxothiolan-3-yl]carbamothioyl]furan-2-carboxamide (PubChem CID 702120) has the molecular formula C10H10N2O3S2 and a molecular weight of 270.33 g/mol. Its IUPAC name is N-[[(3R)-2-oxothiolan-3-yl]carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[[(3R)-2-oxothiolan-3-yl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 702120 |
| Molecular Formula | C10H10N2O3S2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | N-[[(3R)-2-oxothiolan-3-yl]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)N[C@@H]1CCSC1=O)c1ccco1 |
| InChI | InChI=1S/C10H10N2O3S2/c13-8(7-2-1-4-15-7)12-10(16)11-6-3-5-17-9(6)14/h1-2,4,6H,3,5H2,(H2,11,12,13,16)/t6-/m1/s1 |
| InChIKey | HMYADISTWYIYBT-ZCFIWIBFSA-N |
| XLogP | 0.92 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|