C16H23N3O3S — CID 145074745
cyclopropylbenzene;N-(formamidocarbamothioyl)furan-2-carboxamide;molecular hydrogen (PubChem CID 145074745) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is cyclopropylbenzene;N-(formamidocarbamothioyl)furan-2-carboxamide;molecular hydrogen.
| Compound Name | cyclopropylbenzene;N-(formamidocarbamothioyl)furan-2-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 145074745 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | cyclopropylbenzene;N-(formamidocarbamothioyl)furan-2-carboxamide;molecular hydrogen |
| SMILES | O=CNNC(=S)NC(=O)c1ccco1.[H][H].[H][H].[H][H].c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C9H10.C7H7N3O3S.3H2/c1-2-4-8(5-3-1)9-6-7-9;11-4-8-10-7(14)9-6(12)5-2-1-3-13-5;;;/h1-5,9H,6-7H2;1-4H,(H,8,11)(H2,9,10,12,14);3*1H |
| InChIKey | XZQJAEYSWGEFDF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|