C13H10BrN3O3S — CID 4925068
N-[[(2-bromobenzoyl)amino]carbamothioyl]furan-2-carboxamide (PubChem CID 4925068) has the molecular formula C13H10BrN3O3S and a molecular weight of 368.21 g/mol. Its IUPAC name is N-[[(2-bromobenzoyl)amino]carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[[(2-bromobenzoyl)amino]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4925068 |
| Molecular Formula | C13H10BrN3O3S |
| Molecular Weight | 368.21 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | N-[[(2-bromobenzoyl)amino]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)NNC(=O)c1ccccc1Br)c1ccco1 |
| InChI | InChI=1S/C13H10BrN3O3S/c14-9-5-2-1-4-8(9)11(18)16-17-13(21)15-12(19)10-6-3-7-20-10/h1-7H,(H,16,18)(H2,15,17,19,21) |
| InChIKey | JEMGXLVVZPFMAA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|