C16H17N3O4S — CID 17086908
N-[[2-(3-hydroxypropylcarbamoyl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17086908) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is N-[[2-(3-hydroxypropylcarbamoyl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[[2-(3-hydroxypropylcarbamoyl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17086908 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-[[2-(3-hydroxypropylcarbamoyl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccccc1C(=O)NCCCO)c1ccco1 |
| InChI | InChI=1S/C16H17N3O4S/c20-9-4-8-17-14(21)11-5-1-2-6-12(11)18-16(24)19-15(22)13-7-3-10-23-13/h1-3,5-7,10,20H,4,8-9H2,(H,17,21)(H2,18,19,22,24) |
| InChIKey | ZKIYRSQTAUXPSO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|