C7H7N3O3S — CID 145074746
N-(formamidocarbamothioyl)furan-2-carboxamide (PubChem CID 145074746) has the molecular formula C7H7N3O3S and a molecular weight of 213.22 g/mol. Its IUPAC name is N-(formamidocarbamothioyl)furan-2-carboxamide.
| Compound Name | N-(formamidocarbamothioyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 145074746 |
| Molecular Formula | C7H7N3O3S |
| Molecular Weight | 213.22 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | N-(formamidocarbamothioyl)furan-2-carboxamide |
| SMILES | O=CNNC(=S)NC(=O)c1ccco1 |
| InChI | InChI=1S/C7H7N3O3S/c11-4-8-10-7(14)9-6(12)5-2-1-3-13-5/h1-4H,(H,8,11)(H2,9,10,12,14) |
| InChIKey | ZHZBGNSPLQSGPQ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.22 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|