C13H14N2O3S2 — CID 887137
4-methoxy-N-[[(3S)-2-oxothiolan-3-yl]carbamothioyl]benzamide (PubChem CID 887137) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-methoxy-N-[[(3S)-2-oxothiolan-3-yl]carbamothioyl]benzamide.
| Compound Name | 4-methoxy-N-[[(3S)-2-oxothiolan-3-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 887137 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 4-methoxy-N-[[(3S)-2-oxothiolan-3-yl]carbamothioyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(=S)N[C@H]2CCSC2=O)cc1 |
| InChI | InChI=1S/C13H14N2O3S2/c1-18-9-4-2-8(3-5-9)11(16)15-13(19)14-10-6-7-20-12(10)17/h2-5,10H,6-7H2,1H3,(H2,14,15,16,19)/t10-/m0/s1 |
| InChIKey | HXXOSNOXVZHPQT-JTQLQIEISA-N |
| XLogP | 1.33 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|