C9H9FN2OS — CID 4948510
4-fluoro-N-(methylcarbamothioyl)benzamide (PubChem CID 4948510) has the molecular formula C9H9FN2OS and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-fluoro-N-(methylcarbamothioyl)benzamide.
| Compound Name | 4-fluoro-N-(methylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 4948510 |
| Molecular Formula | C9H9FN2OS |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 4-fluoro-N-(methylcarbamothioyl)benzamide |
| SMILES | CNC(=S)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H9FN2OS/c1-11-9(14)12-8(13)6-2-4-7(10)5-3-6/h2-5H,1H3,(H2,11,12,13,14) |
| InChIKey | NVSUENZKFULUDL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|