C17H16FN3O2S — CID 154190201
N-[[(4-fluorobenzoyl)amino]carbamothioyl]-2,6-dimethylbenzamide (PubChem CID 154190201) has the molecular formula C17H16FN3O2S and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[[(4-fluorobenzoyl)amino]carbamothioyl]-2,6-dimethylbenzamide.
| Compound Name | N-[[(4-fluorobenzoyl)amino]carbamothioyl]-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 154190201 |
| Molecular Formula | C17H16FN3O2S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-[[(4-fluorobenzoyl)amino]carbamothioyl]-2,6-dimethylbenzamide |
| SMILES | Cc1cccc(C)c1C(=O)NC(=S)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FN3O2S/c1-10-4-3-5-11(2)14(10)16(23)19-17(24)21-20-15(22)12-6-8-13(18)9-7-12/h3-9H,1-2H3,(H,20,22)(H2,19,21,23,24) |
| InChIKey | IRBIIKASWMYBSZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|