C18H16F3N3O4S — CID 154169462
2,6-dimethoxy-N-[[[3-(trifluoromethyl)benzoyl]amino]carbamothioyl]benzamide (PubChem CID 154169462) has the molecular formula C18H16F3N3O4S and a molecular weight of 427.40 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[[[3-(trifluoromethyl)benzoyl]amino]carbamothioyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[[[3-(trifluoromethyl)benzoyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 154169462 |
| Molecular Formula | C18H16F3N3O4S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 2,6-dimethoxy-N-[[[3-(trifluoromethyl)benzoyl]amino]carbamothioyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(=S)NNC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F3N3O4S/c1-27-12-7-4-8-13(28-2)14(12)16(26)22-17(29)24-23-15(25)10-5-3-6-11(9-10)18(19,20)21/h3-9H,1-2H3,(H,23,25)(H2,22,24,26,29) |
| InChIKey | RZFOIFSHOGDXFZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|