C22H18FN3O3S — CID 4933343
4-fluoro-N-[[(4-phenylmethoxybenzoyl)amino]carbamothioyl]benzamide (PubChem CID 4933343) has the molecular formula C22H18FN3O3S and a molecular weight of 423.47 g/mol. Its IUPAC name is 4-fluoro-N-[[(4-phenylmethoxybenzoyl)amino]carbamothioyl]benzamide.
| Compound Name | 4-fluoro-N-[[(4-phenylmethoxybenzoyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4933343 |
| Molecular Formula | C22H18FN3O3S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 4-fluoro-N-[[(4-phenylmethoxybenzoyl)amino]carbamothioyl]benzamide |
| SMILES | O=C(NNC(=S)NC(=O)c1ccc(F)cc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H18FN3O3S/c23-18-10-6-16(7-11-18)20(27)24-22(30)26-25-21(28)17-8-12-19(13-9-17)29-14-15-4-2-1-3-5-15/h1-13H,14H2,(H,25,28)(H2,24,26,27,30) |
| InChIKey | WBOAVFLFZMMPFL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|