C30H27N3O5S — CID 4954822
2-(2-phenoxyethoxy)-N-[[(4-phenylmethoxybenzoyl)amino]carbamothioyl]benzamide (PubChem CID 4954822) has the molecular formula C30H27N3O5S and a molecular weight of 541.63 g/mol. Its IUPAC name is 2-(2-phenoxyethoxy)-N-[[(4-phenylmethoxybenzoyl)amino]carbamothioyl]benzamide.
| Compound Name | 2-(2-phenoxyethoxy)-N-[[(4-phenylmethoxybenzoyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4954822 |
| Molecular Formula | C30H27N3O5S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 2-(2-phenoxyethoxy)-N-[[(4-phenylmethoxybenzoyl)amino]carbamothioyl]benzamide |
| SMILES | O=C(NNC(=S)NC(=O)c1ccccc1OCCOc1ccccc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H27N3O5S/c34-28(23-15-17-25(18-16-23)38-21-22-9-3-1-4-10-22)32-33-30(39)31-29(35)26-13-7-8-14-27(26)37-20-19-36-24-11-5-2-6-12-24/h1-18H,19-21H2,(H,32,34)(H2,31,33,35,39) |
| InChIKey | OEQZPVUVCIZYME-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|