C29H25N3O4S — CID 4954741
2-(2-phenoxyethoxy)-N-[[(4-phenylbenzoyl)amino]carbamothioyl]benzamide (PubChem CID 4954741) has the molecular formula C29H25N3O4S and a molecular weight of 511.60 g/mol. Its IUPAC name is 2-(2-phenoxyethoxy)-N-[[(4-phenylbenzoyl)amino]carbamothioyl]benzamide.
| Compound Name | 2-(2-phenoxyethoxy)-N-[[(4-phenylbenzoyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4954741 |
| Molecular Formula | C29H25N3O4S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 2-(2-phenoxyethoxy)-N-[[(4-phenylbenzoyl)amino]carbamothioyl]benzamide |
| SMILES | O=C(NNC(=S)NC(=O)c1ccccc1OCCOc1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25N3O4S/c33-27(23-17-15-22(16-18-23)21-9-3-1-4-10-21)31-32-29(37)30-28(34)25-13-7-8-14-26(25)36-20-19-35-24-11-5-2-6-12-24/h1-18H,19-20H2,(H,31,33)(H2,30,32,34,37) |
| InChIKey | QSSGNAZYANAQIP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|