C19H23N5O2S — CID 24788094
4-(dimethylamino)-N-[[[4-(dimethylamino)benzoyl]amino]carbamothioyl]benzamide (PubChem CID 24788094) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[[[4-(dimethylamino)benzoyl]amino]carbamothioyl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[[[4-(dimethylamino)benzoyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 24788094 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 4-(dimethylamino)-N-[[[4-(dimethylamino)benzoyl]amino]carbamothioyl]benzamide |
| SMILES | CN(C)c1ccc(C(=O)NNC(=S)NC(=O)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H23N5O2S/c1-23(2)15-9-5-13(6-10-15)17(25)20-19(27)22-21-18(26)14-7-11-16(12-8-14)24(3)4/h5-12H,1-4H3,(H,21,26)(H2,20,22,25,27) |
| InChIKey | NGECTMHFFZYZDQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|