C11H9Cl2NO2S — CID 743918
2,5-dichloro-N-[(3R)-2-oxothiolan-3-yl]benzamide (PubChem CID 743918) has the molecular formula C11H9Cl2NO2S and a molecular weight of 290.17 g/mol. Its IUPAC name is 2,5-dichloro-N-[(3R)-2-oxothiolan-3-yl]benzamide.
| Compound Name | 2,5-dichloro-N-[(3R)-2-oxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 743918 |
| Molecular Formula | C11H9Cl2NO2S |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | 2,5-dichloro-N-[(3R)-2-oxothiolan-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1CCSC1=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H9Cl2NO2S/c12-6-1-2-8(13)7(5-6)10(15)14-9-3-4-17-11(9)16/h1-2,5,9H,3-4H2,(H,14,15)/t9-/m1/s1 |
| InChIKey | XSZJPQHWEZDVFC-SECBINFHSA-N |
| XLogP | 2.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|