C17H21Cl2N3O3S — CID 71866129
2-[[2-(2,4-dichloroanilino)-2-oxoethyl]-propylamino]-N-(2-oxothiolan-3-yl)acetamide (PubChem CID 71866129) has the molecular formula C17H21Cl2N3O3S and a molecular weight of 418.35 g/mol. Its IUPAC name is 2-[[2-(2,4-dichloroanilino)-2-oxoethyl]-propylamino]-N-(2-oxothiolan-3-yl)acetamide.
| Compound Name | 2-[[2-(2,4-dichloroanilino)-2-oxoethyl]-propylamino]-N-(2-oxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 71866129 |
| Molecular Formula | C17H21Cl2N3O3S |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2-[[2-(2,4-dichloroanilino)-2-oxoethyl]-propylamino]-N-(2-oxothiolan-3-yl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccc(Cl)cc1Cl)CC(=O)NC1CCSC1=O |
| InChI | InChI=1S/C17H21Cl2N3O3S/c1-2-6-22(10-16(24)21-14-5-7-26-17(14)25)9-15(23)20-13-4-3-11(18)8-12(13)19/h3-4,8,14H,2,5-7,9-10H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | ISPATLVIHCAAHS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|