C9H12N2O3S2 — CID 110189672
1,3-bis(2-oxothiolan-3-yl)urea (PubChem CID 110189672) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1,3-bis(2-oxothiolan-3-yl)urea.
| Compound Name | 1,3-bis(2-oxothiolan-3-yl)urea |
|---|---|
| PubChem CID | 110189672 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 1,3-bis(2-oxothiolan-3-yl)urea |
| SMILES | O=C(NC1CCSC1=O)NC1CCSC1=O |
| InChI | InChI=1S/C9H12N2O3S2/c12-7-5(1-3-15-7)10-9(14)11-6-2-4-16-8(6)13/h5-6H,1-4H2,(H2,10,11,14) |
| InChIKey | QGOBOHYWBPGPMN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|