C19H23N5O2S2 — CID 96510597
2-[[4-(4-methylphenyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(3R)-2-oxothiolan-3-yl]acetamide (PubChem CID 96510597) has the molecular formula C19H23N5O2S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-[[4-(4-methylphenyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(3R)-2-oxothiolan-3-yl]acetamide.
| Compound Name | 2-[[4-(4-methylphenyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(3R)-2-oxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 96510597 |
| Molecular Formula | C19H23N5O2S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[[4-(4-methylphenyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(3R)-2-oxothiolan-3-yl]acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)N[C@@H]3CCSC3=O)nnc2N2CCCC2)cc1 |
| InChI | InChI=1S/C19H23N5O2S2/c1-13-4-6-14(7-5-13)24-18(23-9-2-3-10-23)21-22-19(24)28-12-16(25)20-15-8-11-27-17(15)26/h4-7,15H,2-3,8-12H2,1H3,(H,20,25)/t15-/m1/s1 |
| InChIKey | NULRWMAJRDIFBS-OAHLLOKOSA-N |
| XLogP | 2.42 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|