C22H28N4O6S2 — CID 91553556
bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene (PubChem CID 91553556) has the molecular formula C22H28N4O6S2 and a molecular weight of 508.62 g/mol. Its IUPAC name is bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene.
| Compound Name | bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene |
|---|---|
| PubChem CID | 91553556 |
| Molecular Formula | C22H28N4O6S2 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene |
| SMILES | C=C.CC(=O)NNC(=O)CSc1ccc(O)cc1.CC(=O)NNC(=O)CSc1ccc(O)cc1 |
| InChI | InChI=1S/2C10H12N2O3S.C2H4/c2*1-7(13)11-12-10(15)6-16-9-4-2-8(14)3-5-9;1-2/h2*2-5,14H,6H2,1H3,(H,11,13)(H,12,15);1-2H2 |
| InChIKey | MKEKOSGOMGRVTI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|