About bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene
bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene (PubChem CID 91553556) has the molecular formula C22H28N4O6S2
and a molecular weight of 508.62 g/mol. Its IUPAC name is bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene.
Molecular Properties
| Compound Name | bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene |
| PubChem CID | 91553556 |
| Molecular Formula | C22H28N4O6S2 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene |
| SMILES | C=C.CC(=O)NNC(=O)CSc1ccc(O)cc1.CC(=O)NNC(=O)CSc1ccc(O)cc1 |
| InChI | InChI=1S/2C10H12N2O3S.C2H4/c2*1-7(13)11-12-10(15)6-16-9-4-2-8(14)3-5-9;1-2/h2*2-5,14H,6H2,1H3,(H,11,13)(H,12,15);1-2H2 |
| InChIKey | MKEKOSGOMGRVTI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene?
The IUPAC name of bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene (CID 91553556) is bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene.
What is the SMILES notation for bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene?
The canonical SMILES for bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene is C=C.CC(=O)NNC(=O)CSc1ccc(O)cc1.CC(=O)NNC(=O)CSc1ccc(O)cc1.
What is the InChIKey of bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene?
The InChIKey is MKEKOSGOMGRVTI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H12N2O3S.C2H4/c2*1-7(13)11-12-10(15)6-16-9-4-2-8(14)3-5-9;1-2/h2*2-5,14H,6H2,1H3,(H,11,13)(H,12,15);1-2H2.
What are the key properties of bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene?
bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene has a molecular weight of 508.62 g/mol, XLogP of 2.11, 6 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N'-acetyl-2-(4-hydroxyphenyl)sulfanylacetohydrazide);ethene is sourced from PubChem (CID 91553556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).