C9H11N3O2S — CID 37063876
N'-acetyl-2-pyridin-2-ylsulfanylacetohydrazide (PubChem CID 37063876) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is N'-acetyl-2-pyridin-2-ylsulfanylacetohydrazide.
| Compound Name | N'-acetyl-2-pyridin-2-ylsulfanylacetohydrazide |
|---|---|
| PubChem CID | 37063876 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | N'-acetyl-2-pyridin-2-ylsulfanylacetohydrazide |
| SMILES | CC(=O)NNC(=O)CSc1ccccn1 |
| InChI | InChI=1S/C9H11N3O2S/c1-7(13)11-12-8(14)6-15-9-4-2-3-5-10-9/h2-5H,6H2,1H3,(H,11,13)(H,12,14) |
| InChIKey | BCPQCPBAXHUVIY-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|