C8H9N3O2S — CID 5147544
N-carbamoyl-2-pyridin-2-ylsulfanylacetamide (PubChem CID 5147544) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is N-carbamoyl-2-pyridin-2-ylsulfanylacetamide.
| Compound Name | N-carbamoyl-2-pyridin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 5147544 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | N-carbamoyl-2-pyridin-2-ylsulfanylacetamide |
| SMILES | NC(=O)NC(=O)CSc1ccccn1 |
| InChI | InChI=1S/C8H9N3O2S/c9-8(13)11-6(12)5-14-7-3-1-2-4-10-7/h1-4H,5H2,(H3,9,11,12,13) |
| InChIKey | NAMSOMATCWZLPX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |