C9H9N3O4S — CID 61301472
6-[2-(carbamoylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylic acid (PubChem CID 61301472) has the molecular formula C9H9N3O4S and a molecular weight of 255.25 g/mol. Its IUPAC name is 6-[2-(carbamoylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylic acid.
| Compound Name | 6-[2-(carbamoylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 61301472 |
| Molecular Formula | C9H9N3O4S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 6-[2-(carbamoylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylic acid |
| SMILES | NC(=O)NC(=O)CSc1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C9H9N3O4S/c10-9(16)12-6(13)4-17-7-2-1-5(3-11-7)8(14)15/h1-3H,4H2,(H,14,15)(H3,10,12,13,16) |
| InChIKey | YJZKEENZMHYIJW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |