C11H13N3O4S — CID 61304755
6-[2-(ethylcarbamoylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylic acid (PubChem CID 61304755) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is 6-[2-(ethylcarbamoylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylic acid.
| Compound Name | 6-[2-(ethylcarbamoylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 61304755 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 6-[2-(ethylcarbamoylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylic acid |
| SMILES | CCNC(=O)NC(=O)CSc1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C11H13N3O4S/c1-2-12-11(18)14-8(15)6-19-9-4-3-7(5-13-9)10(16)17/h3-5H,2,6H2,1H3,(H,16,17)(H2,12,14,15,18) |
| InChIKey | HSCUIGOMICBKHU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |