C10H13NO4S2 — CID 61304813
6-(2-ethylsulfonylethylsulfanyl)pyridine-3-carboxylic acid (PubChem CID 61304813) has the molecular formula C10H13NO4S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 6-(2-ethylsulfonylethylsulfanyl)pyridine-3-carboxylic acid.
| Compound Name | 6-(2-ethylsulfonylethylsulfanyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 61304813 |
| Molecular Formula | C10H13NO4S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 6-(2-ethylsulfonylethylsulfanyl)pyridine-3-carboxylic acid |
| SMILES | CCS(=O)(=O)CCSc1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C10H13NO4S2/c1-2-17(14,15)6-5-16-9-4-3-8(7-11-9)10(12)13/h3-4,7H,2,5-6H2,1H3,(H,12,13) |
| InChIKey | VSZMJPCALHWWSX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |