C10H11NO2S — CID 61305104
6-but-2-enylsulfanylpyridine-3-carboxylic acid (PubChem CID 61305104) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 6-but-2-enylsulfanylpyridine-3-carboxylic acid.
| Compound Name | 6-but-2-enylsulfanylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 61305104 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 6-but-2-enylsulfanylpyridine-3-carboxylic acid |
| SMILES | CC=CCSc1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C10H11NO2S/c1-2-3-6-14-9-5-4-8(7-11-9)10(12)13/h2-5,7H,6H2,1H3,(H,12,13) |
| InChIKey | CCRYQSRKXJYKMY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|