About benzoic acid;ethyl formate
benzoic acid;ethyl formate (PubChem CID 158867459) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is benzoic acid;ethyl formate.
Molecular Properties
| Compound Name | benzoic acid;ethyl formate |
| PubChem CID | 158867459 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | benzoic acid;ethyl formate |
| SMILES | CCOC=O.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C3H6O2/c8-7(9)6-4-2-1-3-5-6;1-2-5-3-4/h1-5H,(H,8,9);3H,2H2,1H3 |
| InChIKey | JBKOMTBETKSIGE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;ethyl formate?
The IUPAC name of benzoic acid;ethyl formate (CID 158867459) is benzoic acid;ethyl formate.
What is the SMILES notation for benzoic acid;ethyl formate?
The canonical SMILES for benzoic acid;ethyl formate is CCOC=O.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;ethyl formate?
The InChIKey is JBKOMTBETKSIGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C3H6O2/c8-7(9)6-4-2-1-3-5-6;1-2-5-3-4/h1-5H,(H,8,9);3H,2H2,1H3.
What are the key properties of benzoic acid;ethyl formate?
benzoic acid;ethyl formate has a molecular weight of 196.20 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;ethyl formate is sourced from PubChem (CID 158867459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).