C24H34N8S — CID 73212982
1-[2-(dimethylamino)ethyl]-3-[(E)-[(3E)-3-[[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2-pyridinyl]hydrazinylidene]butan-2-ylidene]amino]thiourea (PubChem CID 73212982) has the molecular formula C24H34N8S and a molecular weight of 466.66 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[(E)-[(3E)-3-[[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2-pyridinyl]hydrazinylidene]butan-2-ylidene]amino]thiourea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[(E)-[(3E)-3-[[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2-pyridinyl]hydrazinylidene]butan-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 73212982 |
| Molecular Formula | C24H34N8S |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[(E)-[(3E)-3-[[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2-pyridinyl]hydrazinylidene]butan-2-ylidene]amino]thiourea |
| SMILES | CC(=N\NC(=S)NCCN(C)C)/C(C)=N/Nc1ccc(/C=C/c2ccc(N(C)C)cc2)cn1 |
| InChI | InChI=1S/C24H34N8S/c1-18(19(2)28-30-24(33)25-15-16-31(3)4)27-29-23-14-11-21(17-26-23)8-7-20-9-12-22(13-10-20)32(5)6/h7-14,17H,15-16H2,1-6H3,(H,26,29)(H2,25,30,33)/b8-7+,27-18+,28-19+ |
| InChIKey | NPPTVXLQGIVQJL-ACJYFLHASA-N |
| XLogP | 3.51 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|