C11H14N2S — CID 71356638
3-[4-(dimethylamino)phenyl]prop-2-enethioamide (PubChem CID 71356638) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]prop-2-enethioamide.
| Compound Name | 3-[4-(dimethylamino)phenyl]prop-2-enethioamide |
|---|---|
| PubChem CID | 71356638 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]prop-2-enethioamide |
| SMILES | CN(C)c1ccc(C=CC(N)=S)cc1 |
| InChI | InChI=1S/C11H14N2S/c1-13(2)10-6-3-9(4-7-10)5-8-11(12)14/h3-8H,1-2H3,(H2,12,14) |
| InChIKey | OGJTWKZLCXFDQV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|