C22H30CuN2O4+4 — CID 53298430
copper;bis([(E)-3-[4-(dimethylamino)phenyl]-1-oxonioprop-2-enylidene]oxidanium) (PubChem CID 53298430) has the molecular formula C22H30CuN2O4+4 and a molecular weight of 450.04 g/mol. Its IUPAC name is copper;bis([(E)-3-[4-(dimethylamino)phenyl]-1-oxonioprop-2-enylidene]oxidanium).
| Compound Name | copper;bis([(E)-3-[4-(dimethylamino)phenyl]-1-oxonioprop-2-enylidene]oxidanium) |
|---|---|
| PubChem CID | 53298430 |
| Molecular Formula | C22H30CuN2O4+4 |
| Molecular Weight | 450.04 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | copper;bis([(E)-3-[4-(dimethylamino)phenyl]-1-oxonioprop-2-enylidene]oxidanium) |
| SMILES | [Cu].[H]/[O+]=C([OH2+])\C=C\c1ccc(N(C)C)cc1.[H]/[O+]=C([OH2+])\C=C\c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/2C11H13NO2.Cu/c2*1-12(2)10-6-3-9(4-7-10)5-8-11(13)14;/h2*3-8H,1-2H3,(H,13,14);/p+4/b2*8-5+; |
| InChIKey | ASYJAIVNPZGZKQ-SCMMKMJHSA-R |
| XLogP | 1.98 |
| TPSA | 95.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.04 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|