C16H23N5S2 — CID 157307178
N-[[1-(4-ethylphenyl)-1-(methylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]propanethioamide (PubChem CID 157307178) has the molecular formula C16H23N5S2 and a molecular weight of 349.53 g/mol. Its IUPAC name is N-[[1-(4-ethylphenyl)-1-(methylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]propanethioamide.
| Compound Name | N-[[1-(4-ethylphenyl)-1-(methylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]propanethioamide |
|---|---|
| PubChem CID | 157307178 |
| Molecular Formula | C16H23N5S2 |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-[[1-(4-ethylphenyl)-1-(methylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]propanethioamide |
| SMILES | CCC(=S)NN=C(C)C(=NNC(=S)NC)c1ccc(CC)cc1 |
| InChI | InChI=1S/C16H23N5S2/c1-5-12-7-9-13(10-8-12)15(20-21-16(23)17-4)11(3)18-19-14(22)6-2/h7-10H,5-6H2,1-4H3,(H,19,22)(H2,17,21,23) |
| InChIKey | JQGZCGBSYLYMSH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|