C21H24N6OS2 — CID 158365258
N-[4-[N-(methylcarbamothioylamino)-C-[C-phenyl-N-(propanethioylamino)carbonimidoyl]carbonimidoyl]phenyl]acetamide (PubChem CID 158365258) has the molecular formula C21H24N6OS2 and a molecular weight of 440.60 g/mol. Its IUPAC name is N-[4-[N-(methylcarbamothioylamino)-C-[C-phenyl-N-(propanethioylamino)carbonimidoyl]carbonimidoyl]phenyl]acetamide.
| Compound Name | N-[4-[N-(methylcarbamothioylamino)-C-[C-phenyl-N-(propanethioylamino)carbonimidoyl]carbonimidoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 158365258 |
| Molecular Formula | C21H24N6OS2 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[4-[N-(methylcarbamothioylamino)-C-[C-phenyl-N-(propanethioylamino)carbonimidoyl]carbonimidoyl]phenyl]acetamide |
| SMILES | CCC(=S)NN=C(C(=NNC(=S)NC)c1ccc(NC(C)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H24N6OS2/c1-4-18(29)24-25-19(15-8-6-5-7-9-15)20(26-27-21(30)22-3)16-10-12-17(13-11-16)23-14(2)28/h5-13H,4H2,1-3H3,(H,23,28)(H,24,29)(H2,22,27,30) |
| InChIKey | GQJAJVVDLNRGMD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|