C32H35N7PS2+ — CID 158749013
[[[1-[4-(methylamino)phenyl]-1-(methylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]carbamothioylamino]methyl-triphenylphosphanium (PubChem CID 158749013) has the molecular formula C32H35N7PS2+ and a molecular weight of 612.79 g/mol. Its IUPAC name is [[[1-[4-(methylamino)phenyl]-1-(methylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]carbamothioylamino]methyl-triphenylphosphanium.
| Compound Name | [[[1-[4-(methylamino)phenyl]-1-(methylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]carbamothioylamino]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 158749013 |
| Molecular Formula | C32H35N7PS2+ |
| Molecular Weight | 612.79 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | [[[1-[4-(methylamino)phenyl]-1-(methylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]carbamothioylamino]methyl-triphenylphosphanium |
| SMILES | CNC(=S)NN=C(C(C)=NNC(=S)NC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(NC)cc1 |
| InChI | InChI=1S/C32H34N7PS2/c1-24(30(37-38-31(41)34-3)25-19-21-26(33-2)22-20-25)36-39-32(42)35-23-40(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-22H,23H2,1-3H3,(H4-,33,34,35,36,37,38,39,41,42)/p+1 |
| InChIKey | COUZXIDHLWOURR-UHFFFAOYSA-O |
| XLogP | 4.32 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.79 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|