C32H30BrCuN6OPS2 — CID 160925175
copper;N'-[[1-(4-formylphenyl)-1-[[methylamino(sulfido)methylidene]hydrazinylidene]propan-2-ylidene]amino]-N-(triphenylphosphaniumylmethyl)carbamimidothioate;bromide (PubChem CID 160925175) has the molecular formula C32H30BrCuN6OPS2 and a molecular weight of 753.19 g/mol. Its IUPAC name is copper;N'-[[1-(4-formylphenyl)-1-[[methylamino(sulfido)methylidene]hydrazinylidene]propan-2-ylidene]amino]-N-(triphenylphosphaniumylmethyl)carbamimidothioate;bromide.
| Compound Name | copper;N'-[[1-(4-formylphenyl)-1-[[methylamino(sulfido)methylidene]hydrazinylidene]propan-2-ylidene]amino]-N-(triphenylphosphaniumylmethyl)carbamimidothioate;bromide |
|---|---|
| PubChem CID | 160925175 |
| Molecular Formula | C32H30BrCuN6OPS2 |
| Molecular Weight | 753.19 g/mol |
| Exact Mass | 751.01 |
| IUPAC Name | copper;N'-[[1-(4-formylphenyl)-1-[[methylamino(sulfido)methylidene]hydrazinylidene]propan-2-ylidene]amino]-N-(triphenylphosphaniumylmethyl)carbamimidothioate;bromide |
| SMILES | CNC([S-])=NN=C(C(C)=NN=C([S-])NC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(C=O)cc1.[Br-].[Cu+2] |
| InChI | InChI=1S/C32H31N6OPS2.BrH.Cu/c1-24(30(36-37-31(41)33-2)26-20-18-25(22-39)19-21-26)35-38-32(42)34-23-40(27-12-6-3-7-13-27,28-14-8-4-9-15-28)29-16-10-5-11-17-29;;/h3-22H,23H2,1-2H3,(H3-,33,34,35,36,37,38,39,41,42);1H;/q;;+2/p-2 |
| InChIKey | SSNUEYCKLBBXFM-UHFFFAOYSA-L |
| XLogP | 1.15 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|