C13H15ClCuN6S2 — CID 142539531
copper N'-[(E)-[(1E)-1-(4-chlorophenyl)-1-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]propan-2-ylidene]amino]-N-methylcarbamimidothioate (PubChem CID 142539531) has the molecular formula C13H15ClCuN6S2 and a molecular weight of 418.44 g/mol. Its IUPAC name is copper N'-[(E)-[(1E)-1-(4-chlorophenyl)-1-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]propan-2-ylidene]amino]-N-methylcarbamimidothioate.
| Compound Name | copper N'-[(E)-[(1E)-1-(4-chlorophenyl)-1-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]propan-2-ylidene]amino]-N-methylcarbamimidothioate |
|---|---|
| PubChem CID | 142539531 |
| Molecular Formula | C13H15ClCuN6S2 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | copper N'-[(E)-[(1E)-1-(4-chlorophenyl)-1-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]propan-2-ylidene]amino]-N-methylcarbamimidothioate |
| SMILES | CN/C([S-])=N/N=C(C)/C(=N/N=C(\[S-])NC)c1ccc(Cl)cc1.[Cu+2] |
| InChI | InChI=1S/C13H17ClN6S2.Cu/c1-8(17-19-12(21)15-2)11(18-20-13(22)16-3)9-4-6-10(14)7-5-9;/h4-7H,1-3H3,(H2,15,19,21)(H2,16,20,22);/q;+2/p-2/b17-8+,18-11-; |
| InChIKey | FBEIFRAOOXBRCT-CJOXXPCCSA-L |
| XLogP | 1.66 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|