C14H13CuF6N7S2 — CID 142539340
copper N'-[(E)-[(1E)-1-pyridin-2-yl-1-[(Z)-[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]propan-2-ylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate (PubChem CID 142539340) has the molecular formula C14H13CuF6N7S2 and a molecular weight of 520.98 g/mol. Its IUPAC name is copper N'-[(E)-[(1E)-1-pyridin-2-yl-1-[(Z)-[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]propan-2-ylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate.
| Compound Name | copper N'-[(E)-[(1E)-1-pyridin-2-yl-1-[(Z)-[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]propan-2-ylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate |
|---|---|
| PubChem CID | 142539340 |
| Molecular Formula | C14H13CuF6N7S2 |
| Molecular Weight | 520.98 g/mol |
| Exact Mass | 519.99 |
| IUPAC Name | copper N'-[(E)-[(1E)-1-pyridin-2-yl-1-[(Z)-[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]propan-2-ylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate |
| SMILES | CC(=N\N=C(/[S-])NCC(F)(F)F)/C(=N/N=C(\[S-])NCC(F)(F)F)c1ccccn1.[Cu+2] |
| InChI | InChI=1S/C14H15F6N7S2.Cu/c1-8(24-26-11(28)22-6-13(15,16)17)10(9-4-2-3-5-21-9)25-27-12(29)23-7-14(18,19)20;/h2-5H,6-7H2,1H3,(H2,22,26,28)(H2,23,27,29);/q;+2/p-2/b24-8+,25-10-; |
| InChIKey | HUTGDUGUCVUORC-LLLMUKQESA-L |
| XLogP | 2.27 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.98 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|